![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 0130 calibration not..> | 2001-06-12 07:04 | 149K | |
| 0210 split-splitless..> | 2001-06-12 07:04 | 841K | |
| 0230 cool on-column ..> | 2001-06-12 07:04 | 481K | |
| 0240 PTV inlet.pdf | 2001-06-12 07:04 | 1.1M | |
| 0260 solvent vapor e..> | 2001-06-12 07:05 | 375K | |
| 0270 pneumatics cont..> | 2001-06-12 07:05 | 381K | |
| 0340 ECD detector.pdf | 2001-06-12 07:05 | 549K | |
| 0341 microECD detect..> | 2001-06-12 07:05 | 2.0M | |
| 0360 auxiliary EPC.pdf | 2001-06-12 07:06 | 1.9M | |
| 0410 covers and fans..> | 2001-06-12 07:06 | 1.5M | |
| 0420 oven and temper..> | 2001-06-12 07:06 | 664K | |
| 0430 power-electroni..> | 2001-06-12 07:06 | 1.2M | |
| 0510 environmental.pdf | 2001-06-12 07:06 | 557K | |
| 0520 gases.pdf | 2001-06-12 07:06 | 327K | |
| 0530 power.pdf | 2001-06-12 07:06 | 459K | |
| 0540 instrument spec..> | 2001-06-12 07:06 | 176K | |
| 0610 checkout chroma..> | 2001-06-12 07:06 | 295K | |
| 0810 error codes and..> | 2001-06-12 07:06 | 152K | |
| 0820 not ready messa..> | 2001-06-12 07:06 | 277K | |
| 0830 warning codes.pdf | 2001-06-12 07:06 | 181K | |
| 0840 shutdowns.pdf | 2001-06-12 07:06 | 192K | |
| 0850 faults.pdf | 2001-06-12 07:06 | 292K | |
| 0860 bad mainboard-f..> | 2001-06-12 07:06 | 136K | |
| 1010 cabling diagram..> | 2001-06-12 07:06 | 594K | |
| 1015 cabling diagram..> | 2001-06-12 07:07 | 567K | |
| 1020 cable electroni..> | 2001-06-12 07:07 | 730K | |
| 1110 valves.pdf | 2001-06-12 07:07 | 235K | |
| 1120 valve box.pdf | 2001-06-12 07:07 | 304K | |
| 1130 actuators.pdf | 2001-06-12 07:07 | 833K | |
| 1140 typical valve c..> | 2001-06-12 07:07 | 299K | |
| 1150 troubleshooting..> | 2001-06-12 07:07 | 179K | |
| 1210 external connec..> | 2001-06-12 07:07 | 804K | |
| 1215 external connec..> | 2001-06-12 07:07 | 642K | |
| 1220 main board 6890..> | 2001-06-12 07:07 | 251K | |
| 1225 main board 6890..> | 2001-06-12 07:07 | 1.0M | |
| 1230 power supply.pdf | 2001-06-12 07:07 | 273K | |
| 1240 wiring harnesse..> | 2001-06-12 07:07 | 188K | |
| 1310 inlets.pdf | 2001-06-12 07:07 | 1.9M | |
| 1320 detectors.pdf | 2001-06-12 07:07 | 1.3M | |
| 1330 covers.pdf | 2001-06-12 07:07 | 365K | |
| 1340 oven.pdf | 2001-06-12 07:07 | 360K | |
| 1350 valves.pdf | 2001-06-12 07:07 | 492K | |
| 1360 electrical.pdf | 2001-06-12 07:08 | 1.1M | |
| 6890NTOC.pdf | 2001-06-12 09:26 | 472K | |
| 7683install.pdf | 2001-06-12 07:08 | 698K | |
| 7683service.pdf | 2001-06-12 07:08 | 654K | |
| Contents.htm | 2009-11-17 14:24 | 3.9K | |
| Gcss002.avi | 1999-09-01 01:49 | 7.1M | |
| Index.pdf | 2001-06-12 07:08 | 722K | |
| TOC.pdf | 2001-06-12 07:08 | 151K | |